Explore by Category Petrochemical Standards

Isooctane

Isooctane is a chemical compound widely used in scientific research. With its unique properties, isooctane serves as a valuable solvent, aiding in various experiments and analysis. Its versatility and reliability make it an indispensable material for researchers worldwide.

CAS No.:540-84-1

Molecular Formula:CH3C(CH3)2CH2CH(CH3)2
C8H18
C8H18

Molecular Weight:114.23 g/mol

Availability: In Stock

Dotriacontane

Dotriacontane is a fascinating chemical compound with countless scientific applications. Its long hydrocarbon chain makes it an ideal ingredient in various research fields, such as lubricants, coatings, and even fuel additives. Unlocking its potential can lead to groundbreaking discoveries.

CAS No.:544-85-4

Molecular Formula:C32H66

Molecular Weight:450.9 g/mol

Availability: In Stock

HEXANE

Hexane is a versatile chemical compound widely used in scientific research. It is a hydrocarbon with six carbon atoms, known for its low boiling point and excellent solvent properties. Hexane finds applications in chromatography, extraction techniques, and as a laboratory reagent. Its diverse uses make it indispensable in various scientific investigations.

CAS No.:110-54-3

Molecular Formula:C6H14

Molecular Weight:86.18 g/mol

Availability: In Stock

Hexacosane

Hexacosane is a versatile chemical compound used in various scientific research applications. With its complex molecular structure, it offers intriguing possibilities for studying surface chemistry, material synthesis, and organic reactions. Unlock the potential of hexacosane in your experiments today!

CAS No.:630-01-3

Molecular Formula:C26H54

Molecular Weight:366.7 g/mol

Availability: In Stock

Docosane

Docosane, a chemical compound, is a long-chain alkane with diverse scientific applications. Its complex structure allows for versatile use in scientific research, ranging from solvents and lubricants to drug delivery systems and nanotechnology. Unlocking the potential of Docosane enables groundbreaking advancements in numerous fields.

CAS No.:629-97-0

Molecular Formula:C22H46

Molecular Weight:310.6 g/mol

Availability: In Stock

Cyclooctene

Cyclooctene is a fascinating chemical compound widely used in scientific research. Its unique structure allows for diverse applications, such as catalysts, organic synthesis, and polymer chemistry. With its versatility and potential, Cyclooctene continues to contribute significantly to advancements in various scientific fields.

CAS No.:931-88-4

Molecular Formula:C8H14

Molecular Weight:110.2 g/mol

Availability: In Stock

Electronic Materials

Biomedical Materials

Energy Materials

Screening Compounds

Biochemicals

Chemical Synthesis

Catalysts

Chemical Biology

Flavors & Fragrances

Amino Acids Resins & Reagents

Building Blocks

Lab Chemicals

Stable Isotopes

Formulation

Portfolio APIs

Bioactive Small Molecules

Reference Materials

Analytical Reagents

Analytical Chromatography

Pathways