Explore by Category Solid Formulation

Adipic acid

Adipic acid, a chemical compound, is widely used in scientific research. It serves as a precursor to nylon production and is utilized as a pH regulator and flavoring agent. Moreover, it finds applications in the synthesis of pharmaceuticals and as a corrosion inhibitor. This versatile compound plays an essential role in various scientific investigations.

CAS No.:124-04-9

Molecular Formula:C6H10O4
C6H10O4
HOOC(CH2)4COOH

Molecular Weight:146.14 g/mol

Availability: In Stock

Sorbic acid

Sorbic acid, a chemical compound, is widely used in scientific research. Known for its antimicrobial properties, it inhibits the growth of mold and yeast in various products. Its versatility makes it an essential ingredient in food preservation, cosmetics, and pharmaceuticals. Exploring its potential applications in other scientific fields is an ongoing area of study.

CAS No.:110-44-1

Molecular Formula:C6H8O2
C6H8O2
CH3CH=CHCH=CHCOOH

Molecular Weight:112.13 g/mol

Availability: In Stock

Titanium dioxide

Titanium dioxide, a versatile chemical compound, finds broad applications in scientific research. Known for its exceptional photocatalytic properties, it is used in areas like solar energy, environmental remediation, and antimicrobial coatings. With its extensive range of uses, Titanium dioxide continues to play a pivotal role in various scientific investigations.

CAS No.:13463-67-7

Molecular Formula:O2Ti
TiO2

Molecular Weight:79.866 g/mol

Availability: In Stock

Sucralose

Sucralose is a chemical compound used as a non-nutritive sweetener. It is 600 times sweeter than sugar, making it an ideal substitute. In scientific research, Sucralose finds applications in studying taste perception and metabolic processes. Its unique properties make it a valuable tool for investigating various biological phenomena.

CAS No.:56038-13-2

Molecular Formula:C12H19Cl3O8

Molecular Weight:397.6 g/mol

Availability: In Stock

Citric acid

Citric acid, a versatile chemical compound, is found abundantly in citrus fruits. Widely used in scientific research, it acts as a pH regulator, antioxidant, and chelating agent. Its applications range across food and beverage, pharmaceuticals, and even skincare formulations. Explore the wonders of this multifaceted compound!

CAS No.:77-92-9

Molecular Formula:C6H8O7
C6H8O7
CH2COOH-C(OH)COOH-CH2COOH

Molecular Weight:192.12 g/mol

Availability: In Stock

Palmitic acid; stearic acid

Palmitic acid and stearic acid are chemical compounds commonly found in various natural sources. These saturated fatty acids have significant applications in scientific research, serving as essential building blocks for studying lipid metabolism, formulating drug delivery systems, and investigating skin permeation processes. Their versatility and unique properties make them valuable tools in exploring various scientific fields.

CAS No.:67701-03-5

Molecular Formula:C34H68O4

Molecular Weight:540.9 g/mol

Availability: In Stock

Electronic Materials

Biomedical Materials

Energy Materials

Screening Compounds

Biochemicals

Chemical Synthesis

Catalysts

Chemical Biology

Flavors & Fragrances

Amino Acids Resins & Reagents

Building Blocks

Lab Chemicals

Stable Isotopes

Formulation

Portfolio APIs

Bioactive Small Molecules

Reference Materials

Analytical Reagents

Analytical Chromatography

Pathways